C34H36FNO3 — CID 58952621
(5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-[2-(4-fluorophenyl)ethynyl]-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 58952621) has the molecular formula C34H36FNO3 and a molecular weight of 525.66 g/mol. Its IUPAC name is (5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-[2-(4-fluorophenyl)ethynyl]-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | (5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-[2-(4-fluorophenyl)ethynyl]-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 58952621 |
| Molecular Formula | C34H36FNO3 |
| Molecular Weight | 525.66 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | (5R,6R,9R)-9-[4-(dimethylamino)phenyl]-5-[2-(4-fluorophenyl)ethynyl]-5-hydroxy-6-methyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | CN(C)c1ccc([C@H]2OC[C@@]3(C)C(CC[C@@]3(O)C#Cc3ccc(F)cc3)C3CCC4=CC(=O)CCC4=C32)cc1 |
| InChI | InChI=1S/C34H36FNO3/c1-33-21-39-32(23-6-11-26(12-7-23)36(2)3)31-28-15-13-27(37)20-24(28)8-14-29(31)30(33)17-19-34(33,38)18-16-22-4-9-25(35)10-5-22/h4-7,9-12,20,29-30,32,38H,8,13-15,17,19,21H2,1-3H3/t29?,30?,32-,33+,34+/m1/s1 |
| InChIKey | VZPWPSVYZHAAPV-YZPDVROPSA-N |
| XLogP | 6.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.66 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|