C20H24O5 — CID 58952636
2'-[(2R)-2-formyl-2-methyl-3-oxocyclopentyl]spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbaldehyde (PubChem CID 58952636) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is 2'-[(2R)-2-formyl-2-methyl-3-oxocyclopentyl]spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbaldehyde.
| Compound Name | 2'-[(2R)-2-formyl-2-methyl-3-oxocyclopentyl]spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbaldehyde |
|---|---|
| PubChem CID | 58952636 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | 2'-[(2R)-2-formyl-2-methyl-3-oxocyclopentyl]spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-1'-carbaldehyde |
| SMILES | C[C@@]1(C=O)C(=O)CCC1C1CCC2=CC3(CCC2=C1C=O)OCCO3 |
| InChI | InChI=1S/C20H24O5/c1-19(12-22)17(4-5-18(19)23)15-3-2-13-10-20(24-8-9-25-20)7-6-14(13)16(15)11-21/h10-12,15,17H,2-9H2,1H3/t15?,17?,19-/m0/s1 |
| InChIKey | INKQTGCPCAHRSX-KVWWFHCMSA-N |
| XLogP | 2.54 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|