C26H44O5Si — CID 58952642
cis-(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[1'-(hydroxymethyl)spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-2'-yl]-2-methylcyclopentan-1-ol (PubChem CID 58952642) has the molecular formula C26H44O5Si and a molecular weight of 464.72 g/mol. Its IUPAC name is cis-(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[1'-(hydroxymethyl)spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-2'-yl]-2-methylcyclopentan-1-ol.
| Compound Name | cis-(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[1'-(hydroxymethyl)spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-2'-yl]-2-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 58952642 |
| Molecular Formula | C26H44O5Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | cis-(1S,2R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-[1'-(hydroxymethyl)spiro[1,3-dioxolane-2,6'-3,4,7,8-tetrahydro-2H-naphthalene]-2'-yl]-2-methylcyclopentan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]1(C)C(C2CCC3=CC4(CCC3=C2CO)OCCO4)CC[C@@H]1O |
| InChI | InChI=1S/C26H44O5Si/c1-24(2,3)32(5,6)31-17-25(4)22(9-10-23(25)28)20-8-7-18-15-26(29-13-14-30-26)12-11-19(18)21(20)16-27/h15,20,22-23,27-28H,7-14,16-17H2,1-6H3/t20?,22?,23-,25-/m0/s1 |
| InChIKey | WUTZDIDJDURFDQ-NUXSIXSXSA-N |
| XLogP | 4.95 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|