C28H32O4S — CID 58952647
(5S,6R,9R)-5-hydroxy-6-methyl-9-(4-methylsulfanylphenyl)-5-prop-2-enoyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 58952647) has the molecular formula C28H32O4S and a molecular weight of 464.63 g/mol. Its IUPAC name is (5S,6R,9R)-5-hydroxy-6-methyl-9-(4-methylsulfanylphenyl)-5-prop-2-enoyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | (5S,6R,9R)-5-hydroxy-6-methyl-9-(4-methylsulfanylphenyl)-5-prop-2-enoyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 58952647 |
| Molecular Formula | C28H32O4S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (5S,6R,9R)-5-hydroxy-6-methyl-9-(4-methylsulfanylphenyl)-5-prop-2-enoyl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | C=CC(=O)[C@]1(O)CCC2C3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(SC)cc3)OC[C@@]21C |
| InChI | InChI=1S/C28H32O4S/c1-4-24(30)28(31)14-13-23-22-11-7-18-15-19(29)8-12-21(18)25(22)26(32-16-27(23,28)2)17-5-9-20(33-3)10-6-17/h4-6,9-10,15,22-23,26,31H,1,7-8,11-14,16H2,2-3H3/t22?,23?,26-,27+,28-/m1/s1 |
| InChIKey | XWCOTJXDGZWCHZ-XYWHMWSZSA-N |
| XLogP | 5.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|