C28H34O5S — CID 58952655
(5R,6R,9S)-5-hydroxy-6-methyl-9-(4-methylsulfonylphenyl)-5-prop-1-en-2-yl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one (PubChem CID 58952655) has the molecular formula C28H34O5S and a molecular weight of 482.64 g/mol. Its IUPAC name is (5R,6R,9S)-5-hydroxy-6-methyl-9-(4-methylsulfonylphenyl)-5-prop-1-en-2-yl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one.
| Compound Name | (5R,6R,9S)-5-hydroxy-6-methyl-9-(4-methylsulfonylphenyl)-5-prop-1-en-2-yl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
|---|---|
| PubChem CID | 58952655 |
| Molecular Formula | C28H34O5S |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (5R,6R,9S)-5-hydroxy-6-methyl-9-(4-methylsulfonylphenyl)-5-prop-1-en-2-yl-8-oxatetracyclo[8.8.0.02,6.011,16]octadeca-10,15-dien-14-one |
| SMILES | C=C(C)[C@]1(O)CCC2C3CCC4=CC(=O)CCC4=C3[C@H](c3ccc(S(C)(=O)=O)cc3)OC[C@@]21C |
| InChI | InChI=1S/C28H34O5S/c1-17(2)28(30)14-13-24-23-11-7-19-15-20(29)8-12-22(19)25(23)26(33-16-27(24,28)3)18-5-9-21(10-6-18)34(4,31)32/h5-6,9-10,15,23-24,26,30H,1,7-8,11-14,16H2,2-4H3/t23?,24?,26-,27-,28+/m0/s1 |
| InChIKey | RPHZKNSCEWZAMO-LYXSDVJCSA-N |
| XLogP | 4.88 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|