About 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide
5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide (PubChem CID 58952997) has the molecular formula C10H10ClF6NO2S2
and a molecular weight of 389.77 g/mol. Its IUPAC name is 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide |
| PubChem CID | 58952997 |
| Molecular Formula | C10H10ClF6NO2S2 |
| Molecular Weight | 389.77 g/mol |
| Exact Mass | 388.97 |
| IUPAC Name | 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(Cl)s1)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H10ClF6NO2S2/c1-2-5(8(9(12,13)14)10(15,16)17)18-22(19,20)7-4-3-6(11)21-7/h3-5,8,18H,2H2,1H3 |
| InChIKey | GUIBLDCYPPHGER-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.77 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide?
The IUPAC name of 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide (CID 58952997) is 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide?
The canonical SMILES for 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide is CCC(NS(=O)(=O)c1ccc(Cl)s1)C(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide?
The InChIKey is GUIBLDCYPPHGER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClF6NO2S2/c1-2-5(8(9(12,13)14)10(15,16)17)18-22(19,20)7-4-3-6(11)21-7/h3-5,8,18H,2H2,1H3.
What are the key properties of 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide?
5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide has a molecular weight of 389.77 g/mol, XLogP of 4.20, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[1,1,1-trifluoro-2-(trifluoromethyl)pentan-3-yl]thiophene-2-sulfonamide is sourced from PubChem (CID 58952997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).