C17H16N2O3 — CID 589530
2-[(1,2-dimethylindol-3-yl)methyl]-4-nitrophenol (PubChem CID 589530) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[(1,2-dimethylindol-3-yl)methyl]-4-nitrophenol.
| Compound Name | 2-[(1,2-dimethylindol-3-yl)methyl]-4-nitrophenol |
|---|---|
| PubChem CID | 589530 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[(1,2-dimethylindol-3-yl)methyl]-4-nitrophenol |
| SMILES | Cc1c(Cc2cc([N+](=O)[O-])ccc2O)c2ccccc2n1C |
| InChI | InChI=1S/C17H16N2O3/c1-11-15(14-5-3-4-6-16(14)18(11)2)10-12-9-13(19(21)22)7-8-17(12)20/h3-9,20H,10H2,1-2H3 |
| InChIKey | LNMQTILJPCIKCZ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|