C25H28F4 — CID 58953489
3-fluoro-1-[(E)-prop-1-enyl]-4-[4-(4-propylcyclohexyl)phenyl]-2-(trifluoromethyl)benzene (PubChem CID 58953489) has the molecular formula C25H28F4 and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-fluoro-1-[(E)-prop-1-enyl]-4-[4-(4-propylcyclohexyl)phenyl]-2-(trifluoromethyl)benzene.
| Compound Name | 3-fluoro-1-[(E)-prop-1-enyl]-4-[4-(4-propylcyclohexyl)phenyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 58953489 |
| Molecular Formula | C25H28F4 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 3-fluoro-1-[(E)-prop-1-enyl]-4-[4-(4-propylcyclohexyl)phenyl]-2-(trifluoromethyl)benzene |
| SMILES | C/C=C/c1ccc(-c2ccc(C3CCC(CCC)CC3)cc2)c(F)c1C(F)(F)F |
| InChI | InChI=1S/C25H28F4/c1-3-5-17-7-9-18(10-8-17)19-11-13-20(14-12-19)22-16-15-21(6-4-2)23(24(22)26)25(27,28)29/h4,6,11-18H,3,5,7-10H2,1-2H3/b6-4+ |
| InChIKey | POQAEOXAYZHYIE-GQCTYLIASA-N |
| XLogP | 8.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |