C74H48N6 — CID 58953615
5-[5-[6-[5-(1,2-diphenylbenzimidazol-5-yl)-3-pyridinyl]-9,10-diphenylanthracen-2-yl]-3-pyridinyl]-1,2-diphenylbenzimidazole (PubChem CID 58953615) has the molecular formula C74H48N6 and a molecular weight of 1021.24 g/mol. Its IUPAC name is 5-[5-[6-[5-(1,2-diphenylbenzimidazol-5-yl)-3-pyridinyl]-9,10-diphenylanthracen-2-yl]-3-pyridinyl]-1,2-diphenylbenzimidazole.
| Compound Name | 5-[5-[6-[5-(1,2-diphenylbenzimidazol-5-yl)-3-pyridinyl]-9,10-diphenylanthracen-2-yl]-3-pyridinyl]-1,2-diphenylbenzimidazole |
|---|---|
| PubChem CID | 58953615 |
| Molecular Formula | C74H48N6 |
| Molecular Weight | 1021.24 g/mol |
| Exact Mass | 1020.39 |
| IUPAC Name | 5-[5-[6-[5-(1,2-diphenylbenzimidazol-5-yl)-3-pyridinyl]-9,10-diphenylanthracen-2-yl]-3-pyridinyl]-1,2-diphenylbenzimidazole |
| SMILES | c1ccc(-c2c3ccc(-c4cncc(-c5ccc6c(c5)nc(-c5ccccc5)n6-c5ccccc5)c4)cc3c(-c3ccccc3)c3ccc(-c4cncc(-c5ccc6c(c5)nc(-c5ccccc5)n6-c5ccccc5)c4)cc23)cc1 |
| InChI | InChI=1S/C74H48N6/c1-7-19-49(20-8-1)71-63-35-31-54(58-40-60(48-76-46-58)56-34-38-70-68(44-56)78-74(52-25-13-4-14-26-52)80(70)62-29-17-6-18-30-62)42-66(63)72(50-21-9-2-10-22-50)64-36-32-53(41-65(64)71)57-39-59(47-75-45-57)55-33-37-69-67(43-55)77-73(51-23-11-3-12-24-51)79(69)61-27-15-5-16-28-61/h1-48H |
| InChIKey | ODKYHFQRJVNANW-UHFFFAOYSA-N |
| XLogP | 18.80 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.24 |
| LogP ≤ 5 | 18.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|