C56H42N4 — CID 58953632
5-[4-[6-[4-(1,2-dimethylbenzimidazol-5-yl)phenyl]-9,10-diphenylanthracen-2-yl]phenyl]-1,2-dimethylbenzimidazole (PubChem CID 58953632) has the molecular formula C56H42N4 and a molecular weight of 770.98 g/mol. Its IUPAC name is 5-[4-[6-[4-(1,2-dimethylbenzimidazol-5-yl)phenyl]-9,10-diphenylanthracen-2-yl]phenyl]-1,2-dimethylbenzimidazole.
| Compound Name | 5-[4-[6-[4-(1,2-dimethylbenzimidazol-5-yl)phenyl]-9,10-diphenylanthracen-2-yl]phenyl]-1,2-dimethylbenzimidazole |
|---|---|
| PubChem CID | 58953632 |
| Molecular Formula | C56H42N4 |
| Molecular Weight | 770.98 g/mol |
| Exact Mass | 770.34 |
| IUPAC Name | 5-[4-[6-[4-(1,2-dimethylbenzimidazol-5-yl)phenyl]-9,10-diphenylanthracen-2-yl]phenyl]-1,2-dimethylbenzimidazole |
| SMILES | Cc1nc2cc(-c3ccc(-c4ccc5c(-c6ccccc6)c6cc(-c7ccc(-c8ccc9c(c8)nc(C)n9C)cc7)ccc6c(-c6ccccc6)c5c4)cc3)ccc2n1C |
| InChI | InChI=1S/C56H42N4/c1-35-57-51-33-45(25-29-53(51)59(35)3)39-19-15-37(16-20-39)43-23-27-47-49(31-43)55(41-11-7-5-8-12-41)48-28-24-44(32-50(48)56(47)42-13-9-6-10-14-42)38-17-21-40(22-18-38)46-26-30-54-52(34-46)58-36(2)60(54)4/h5-34H,1-4H3 |
| InChIKey | NRUXEAZVLUEPPK-UHFFFAOYSA-N |
| XLogP | 14.39 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.98 |
| LogP ≤ 5 | 14.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|