C68H44N6 — CID 58953722
5-[6-[5-(1,2-diphenylbenzimidazol-5-yl)-2-pyridinyl]-9,10-diphenylanthracen-2-yl]-2-phenyl-1-pyridin-2-ylbenzimidazole (PubChem CID 58953722) has the molecular formula C68H44N6 and a molecular weight of 945.14 g/mol. Its IUPAC name is 5-[6-[5-(1,2-diphenylbenzimidazol-5-yl)-2-pyridinyl]-9,10-diphenylanthracen-2-yl]-2-phenyl-1-pyridin-2-ylbenzimidazole.
| Compound Name | 5-[6-[5-(1,2-diphenylbenzimidazol-5-yl)-2-pyridinyl]-9,10-diphenylanthracen-2-yl]-2-phenyl-1-pyridin-2-ylbenzimidazole |
|---|---|
| PubChem CID | 58953722 |
| Molecular Formula | C68H44N6 |
| Molecular Weight | 945.14 g/mol |
| Exact Mass | 944.36 |
| IUPAC Name | 5-[6-[5-(1,2-diphenylbenzimidazol-5-yl)-2-pyridinyl]-9,10-diphenylanthracen-2-yl]-2-phenyl-1-pyridin-2-ylbenzimidazole |
| SMILES | c1ccc(-c2c3ccc(-c4ccc(-c5ccc6c(c5)nc(-c5ccccc5)n6-c5ccccc5)cn4)cc3c(-c3ccccc3)c3ccc(-c4ccc5c(c4)nc(-c4ccccc4)n5-c4ccccn4)cc23)cc1 |
| InChI | InChI=1S/C68H44N6/c1-6-18-45(19-7-1)65-56-35-30-52(59-36-31-53(44-70-59)51-33-37-62-60(43-51)71-67(47-22-10-3-11-23-47)73(62)54-26-14-5-15-27-54)41-58(56)66(46-20-8-2-9-21-46)55-34-29-49(40-57(55)65)50-32-38-63-61(42-50)72-68(48-24-12-4-13-25-48)74(63)64-28-16-17-39-69-64/h1-44H |
| InChIKey | GJTDJCJBMXEFJP-UHFFFAOYSA-N |
| XLogP | 17.13 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.14 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|