C37H41N3O6 — CID 58954203
15-methyl-6,9,12,18,21,24-hexaoxa-15,38,41-triazahexacyclo[27.8.4.22,5.225,28.032,40.035,39]pentatetraconta-1(38),2(45),3,5(44),25(43),26,28(42),29(41),30,32(40),33,35(39),36-tridecaene (PubChem CID 58954203) has the molecular formula C37H41N3O6 and a molecular weight of 623.75 g/mol. Its IUPAC name is 15-methyl-6,9,12,18,21,24-hexaoxa-15,38,41-triazahexacyclo[27.8.4.22,5.225,28.032,40.035,39]pentatetraconta-1(38),2(45),3,5(44),25(43),26,28(42),29(41),30,32(40),33,35(39),36-tridecaene.
| Compound Name | 15-methyl-6,9,12,18,21,24-hexaoxa-15,38,41-triazahexacyclo[27.8.4.22,5.225,28.032,40.035,39]pentatetraconta-1(38),2(45),3,5(44),25(43),26,28(42),29(41),30,32(40),33,35(39),36-tridecaene |
|---|---|
| PubChem CID | 58954203 |
| Molecular Formula | C37H41N3O6 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | 15-methyl-6,9,12,18,21,24-hexaoxa-15,38,41-triazahexacyclo[27.8.4.22,5.225,28.032,40.035,39]pentatetraconta-1(38),2(45),3,5(44),25(43),26,28(42),29(41),30,32(40),33,35(39),36-tridecaene |
| SMILES | CN1CCOCCOCCOc2ccc(cc2)-c2ccc3ccc4ccc(nc4c3n2)-c2ccc(cc2)OCCOCCOCC1 |
| InChI | InChI=1S/C37H41N3O6/c1-40-16-18-41-20-22-43-24-26-45-32-10-4-28(5-11-32)34-14-8-30-2-3-31-9-15-35(39-37(31)36(30)38-34)29-6-12-33(13-7-29)46-27-25-44-23-21-42-19-17-40/h2-15H,16-27H2,1H3 |
| InChIKey | ACNUWZYNNKDMNC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 84.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|