About CID 58954215
CID 58954215 (PubChem CID 58954215) has the molecular formula C75H60IrN9O4
and a molecular weight of 1343.58 g/mol.
Molecular Properties
| Compound Name | CID 58954215 |
| PubChem CID | 58954215 |
| Molecular Formula | C75H60IrN9O4 |
| Molecular Weight | 1343.58 g/mol |
| Exact Mass | 1343.44 |
| IUPAC Name | — |
| SMILES | [Ir+3].[c-]1c2cccc1-c1ccc(cn1)OCCCc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)CCCOc1ccc-2nc1.[c-]1cc2ccc1-c1cccc(n1)-c1[c-]cc(cc1)OCCCc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)CCCO2 |
| InChI | InChI=1S/C38H30N4O2.C37H30N5O2.Ir/c1-7-33-29-13-17-31(18-14-29)43-23-3-5-27-11-21-35(39-25-27)37-9-2-10-38(42-37)36-22-12-28(26-40-36)6-4-24-44-32-19-15-30(16-20-32)34(8-1)41-33;1-7-28-21-29(8-1)33-18-14-31(25-41-33)44-20-4-6-27-12-16-35(39-23-27)37-10-2-9-36(42-37)34-15-11-26(22-38-34)5-3-19-43-30-13-17-32(28)40-24-30;/h1-2,7-13,15,17-22,25-26H,3-6,23-24H2;1-2,7-18,22-25H,3-6,19-20H2;/q-2;-1;+3 |
| InChIKey | YIYYOFWWRFJZFH-UHFFFAOYSA-N |
| XLogP | 15.34 |
| TPSA | 152.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | |
| Heavy Atoms | 89 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1343.58 |
| LogP ≤ 5 | 15.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58954215 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58954215?
The IUPAC name of CID 58954215 (CID 58954215) is not available.
What is the SMILES notation for CID 58954215?
The canonical SMILES for CID 58954215 is [Ir+3].[c-]1c2cccc1-c1ccc(cn1)OCCCc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)CCCOc1ccc-2nc1.[c-]1cc2ccc1-c1cccc(n1)-c1[c-]cc(cc1)OCCCc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)CCCO2.
What is the InChIKey of CID 58954215?
The InChIKey is YIYYOFWWRFJZFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H30N4O2.C37H30N5O2.Ir/c1-7-33-29-13-17-31(18-14-29)43-23-3-5-27-11-21-35(39-25-27)37-9-2-10-38(42-37)36-22-12-28(26-40-36)6-4-24-44-32-19-15-30(16-20-32)34(8-1)41-33;1-7-28-21-29(8-1)33-18-14-31(25-41-33)44-20-4-6-27-12-16-35(39-23-27)37-10-2-9-36(42-37)34-15-11-26(22-38-34)5-3-19-43-30-13-17-32(28)40-24-30;/h1-2,7-13,15,17-22,25-26H,3-6,23-24H2;1-2,7-18,22-25H,3-6,19-20H2;/q-2;-1;+3.
What are the key properties of CID 58954215?
CID 58954215 has a molecular weight of 1343.58 g/mol, XLogP of 15.34, 0 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58954215 is sourced from PubChem (CID 58954215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).