About CID 58954229
CID 58954229 (PubChem CID 58954229) has the molecular formula C69H70N5O11Pt-
and a molecular weight of 1340.42 g/mol.
Molecular Properties
| Compound Name | CID 58954229 |
| PubChem CID | 58954229 |
| Molecular Formula | C69H70N5O11Pt- |
| Molecular Weight | 1340.42 g/mol |
| Exact Mass | 1339.47 |
| IUPAC Name | — |
| SMILES | Oc1c2cccc1-c1ccc(cc1)OCCCc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)CCCOc1ccc-2cc1.[Pt].[c-]1c2cccc1-c1ccc(cn1)OCCOCCOCCOCCOCCOCCOCCOc1ccc-2nc1 |
| InChI | InChI=1S/C39H33N3O3.C30H37N2O8.Pt/c43-39-33-7-1-8-34(39)30-15-19-32(20-16-30)45-24-4-6-28-12-22-36(41-26-28)38-10-2-9-37(42-38)35-21-11-27(25-40-35)5-3-23-44-31-17-13-29(33)14-18-31;1-2-25-22-26(3-1)30-7-5-28(24-32-30)40-21-19-38-17-15-36-13-11-34-9-8-33-10-12-35-14-16-37-18-20-39-27-4-6-29(25)31-23-27;/h1-2,7-22,25-26,43H,3-6,23-24H2;1-7,23-24H,8-21H2;/q;-1; |
| InChIKey | SBIJKRUIKVIUFI-UHFFFAOYSA-N |
| XLogP | 12.06 |
| TPSA | 176.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | |
| Heavy Atoms | 86 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1340.42 |
| LogP ≤ 5 | 12.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze CID 58954229 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58954229?
The IUPAC name of CID 58954229 (CID 58954229) is not available.
What is the SMILES notation for CID 58954229?
The canonical SMILES for CID 58954229 is Oc1c2cccc1-c1ccc(cc1)OCCCc1ccc(nc1)-c1cccc(n1)-c1ccc(cn1)CCCOc1ccc-2cc1.[Pt].[c-]1c2cccc1-c1ccc(cn1)OCCOCCOCCOCCOCCOCCOCCOc1ccc-2nc1.
What is the InChIKey of CID 58954229?
The InChIKey is SBIJKRUIKVIUFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H33N3O3.C30H37N2O8.Pt/c43-39-33-7-1-8-34(39)30-15-19-32(20-16-30)45-24-4-6-28-12-22-36(41-26-28)38-10-2-9-37(42-38)35-21-11-27(25-40-35)5-3-23-44-31-17-13-29(33)14-18-31;1-2-25-22-26(3-1)30-7-5-28(24-32-30)40-21-19-38-17-15-36-13-11-34-9-8-33-10-12-35-14-16-37-18-20-39-27-4-6-29(25)31-23-27;/h1-2,7-22,25-26,43H,3-6,23-24H2;1-7,23-24H,8-21H2;/q;-1;.
What are the key properties of CID 58954229?
CID 58954229 has a molecular weight of 1340.42 g/mol, XLogP of 12.06, 0 rotatable bonds, 1 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58954229 is sourced from PubChem (CID 58954229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).