C19H17ClF3N7O2 — CID 58955292
(2R,5S)-1-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-2-N-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dicarboxamide (PubChem CID 58955292) has the molecular formula C19H17ClF3N7O2 and a molecular weight of 467.84 g/mol. Its IUPAC name is (2R,5S)-1-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-2-N-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dicarboxamide.
| Compound Name | (2R,5S)-1-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-2-N-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 58955292 |
| Molecular Formula | C19H17ClF3N7O2 |
| Molecular Weight | 467.84 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | (2R,5S)-1-[2-(5-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]-2-N-(2,2,2-trifluoroethyl)pyrrolidine-2,5-dicarboxamide |
| SMILES | NC(=O)[C@@H]1CC[C@H](C(=O)NCC(F)(F)F)N1c1ccnc(-c2c[nH]c3ncc(Cl)cc23)n1 |
| InChI | InChI=1S/C19H17ClF3N7O2/c20-9-5-10-11(7-27-16(10)26-6-9)17-25-4-3-14(29-17)30-12(15(24)31)1-2-13(30)18(32)28-8-19(21,22)23/h3-7,12-13H,1-2,8H2,(H2,24,31)(H,26,27)(H,28,32)/t12-,13+/m0/s1 |
| InChIKey | FDLUBCMYCOULLK-QWHCGFSZSA-N |
| XLogP | 2.17 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.84 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |