About cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol
cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol (PubChem CID 58955830) has the molecular formula C17H21F3N2OS
and a molecular weight of 358.43 g/mol. Its IUPAC name is cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol.
Molecular Properties
| Compound Name | cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol |
| PubChem CID | 58955830 |
| Molecular Formula | C17H21F3N2OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol |
| SMILES | Cc1c(-c2ccc(C(O)C3CCCCC3)s2)nn(C)c1C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2OS/c1-10-14(21-22(2)16(10)17(18,19)20)12-8-9-13(24-12)15(23)11-6-4-3-5-7-11/h8-9,11,15,23H,3-7H2,1-2H3 |
| InChIKey | ZTCJIDYIRRLPTJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol?
The IUPAC name of cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol (CID 58955830) is cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol.
What is the SMILES notation for cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol?
The canonical SMILES for cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol is Cc1c(-c2ccc(C(O)C3CCCCC3)s2)nn(C)c1C(F)(F)F.
What is the InChIKey of cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol?
The InChIKey is ZTCJIDYIRRLPTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F3N2OS/c1-10-14(21-22(2)16(10)17(18,19)20)12-8-9-13(24-12)15(23)11-6-4-3-5-7-11/h8-9,11,15,23H,3-7H2,1-2H3.
What are the key properties of cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol?
cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol has a molecular weight of 358.43 g/mol, XLogP of 5.09, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[5-[1,4-dimethyl-5-(trifluoromethyl)pyrazol-3-yl]thiophen-2-yl]methanol is sourced from PubChem (CID 58955830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).