C17H18F3N3O — CID 58955857
[4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenyl]-piperidin-1-ylmethanone (PubChem CID 58955857) has the molecular formula C17H18F3N3O and a molecular weight of 337.35 g/mol. Its IUPAC name is [4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 58955857 |
| Molecular Formula | C17H18F3N3O |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [4-[1-methyl-5-(trifluoromethyl)pyrazol-3-yl]phenyl]-piperidin-1-ylmethanone |
| SMILES | Cn1nc(-c2ccc(C(=O)N3CCCCC3)cc2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H18F3N3O/c1-22-15(17(18,19)20)11-14(21-22)12-5-7-13(8-6-12)16(24)23-9-3-2-4-10-23/h5-8,11H,2-4,9-10H2,1H3 |
| InChIKey | FIXBSSPLJGNJIU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |