About 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine
3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine (PubChem CID 58956260) has the molecular formula C17H15F2N3O
and a molecular weight of 315.32 g/mol. Its IUPAC name is 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine |
| PubChem CID | 58956260 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine |
| SMILES | Fc1ccc(Oc2cc3n[nH]c(C4CCCC4)c3cn2)c(F)c1 |
| InChI | InChI=1S/C17H15F2N3O/c18-11-5-6-15(13(19)7-11)23-16-8-14-12(9-20-16)17(22-21-14)10-3-1-2-4-10/h5-10H,1-4H2,(H,21,22) |
| InChIKey | FBGTURMJHRXPOA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine?
The IUPAC name of 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine (CID 58956260) is 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine?
The canonical SMILES for 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine is Fc1ccc(Oc2cc3n[nH]c(C4CCCC4)c3cn2)c(F)c1.
What is the InChIKey of 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine?
The InChIKey is FBGTURMJHRXPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N3O/c18-11-5-6-15(13(19)7-11)23-16-8-14-12(9-20-16)17(22-21-14)10-3-1-2-4-10/h5-10H,1-4H2,(H,21,22).
What are the key properties of 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine?
3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine has a molecular weight of 315.32 g/mol, XLogP of 4.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-6-(2,4-difluorophenoxy)-2H-pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 58956260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).