C28H39N3O2 — CID 58956359
3-[9-tert-butyl-2-[(4-methylpiperazin-1-yl)methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol (PubChem CID 58956359) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 3-[9-tert-butyl-2-[(4-methylpiperazin-1-yl)methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol.
| Compound Name | 3-[9-tert-butyl-2-[(4-methylpiperazin-1-yl)methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol |
|---|---|
| PubChem CID | 58956359 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 3-[9-tert-butyl-2-[(4-methylpiperazin-1-yl)methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol |
| SMILES | CN1CCN(CC2CCC3C(c4cccc(O)c4)Nc4ccc(C(C)(C)C)cc4C3O2)CC1 |
| InChI | InChI=1S/C28H39N3O2/c1-28(2,3)20-8-11-25-24(17-20)27-23(26(29-25)19-6-5-7-21(32)16-19)10-9-22(33-27)18-31-14-12-30(4)13-15-31/h5-8,11,16-17,22-23,26-27,29,32H,9-10,12-15,18H2,1-4H3 |
| InChIKey | ZHRKRRNNVDVVIA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 47.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |