C22H27NO3 — CID 58956386
5-[(4aS,5R,10bS)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]benzene-1,3-diol (PubChem CID 58956386) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 5-[(4aS,5R,10bS)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]benzene-1,3-diol.
| Compound Name | 5-[(4aS,5R,10bS)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 58956386 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 5-[(4aS,5R,10bS)-9-tert-butyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]benzene-1,3-diol |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@H]1OCCC[C@H]1[C@H](c1cc(O)cc(O)c1)N2 |
| InChI | InChI=1S/C22H27NO3/c1-22(2,3)14-6-7-19-18(11-14)21-17(5-4-8-26-21)20(23-19)13-9-15(24)12-16(25)10-13/h6-7,9-12,17,20-21,23-25H,4-5,8H2,1-3H3/t17-,20-,21-/m0/s1 |
| InChIKey | AYFAFIVQTOHKEE-YYWHXJBOSA-N |
| XLogP | 5.03 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |