C34H42BrN3O2 — CID 58956392
4-bromo-N-[(9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl)methyl]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 58956392) has the molecular formula C34H42BrN3O2 and a molecular weight of 604.63 g/mol. Its IUPAC name is 4-bromo-N-[(9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl)methyl]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 4-bromo-N-[(9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl)methyl]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 58956392 |
| Molecular Formula | C34H42BrN3O2 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 4-bromo-N-[(9-tert-butyl-5-phenyl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl)methyl]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | CN(C)CCN(CC1CCC2C(c3ccccc3)Nc3ccc(C(C)(C)C)cc3C2O1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C34H42BrN3O2/c1-34(2,3)25-13-18-30-29(21-25)32-28(31(36-30)23-9-7-6-8-10-23)17-16-27(40-32)22-38(20-19-37(4)5)33(39)24-11-14-26(35)15-12-24/h6-15,18,21,27-28,31-32,36H,16-17,19-20,22H2,1-5H3 |
| InChIKey | RNIKDZQQZMYJLZ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |