C27H34F3N3O — CID 58956403
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N,1-dimethylpiperidin-4-amine (PubChem CID 58956403) has the molecular formula C27H34F3N3O and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N,1-dimethylpiperidin-4-amine.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 58956403 |
| Molecular Formula | C27H34F3N3O |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N,1-dimethylpiperidin-4-amine |
| SMILES | CN1CCC(N(C)C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C27H34F3N3O/c1-32-14-12-20(13-15-32)33(2)17-21-9-10-22-25(18-6-4-3-5-7-18)31-24-11-8-19(27(28,29)30)16-23(24)26(22)34-21/h3-8,11,16,20-22,25-26,31H,9-10,12-15,17H2,1-2H3/t21-,22+,25+,26+/m1/s1 |
| InChIKey | BASSZTWGEMONOK-HRHCJDDBSA-N |
| XLogP | 5.73 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |