C19H17F4NO — CID 58956436
(4aS,5R,10bS)-5-(3-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956436) has the molecular formula C19H17F4NO and a molecular weight of 351.34 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-(3-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-5-(3-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956436 |
| Molecular Formula | C19H17F4NO |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | (4aS,5R,10bS)-5-(3-fluorophenyl)-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Fc1cccc([C@@H]2Nc3ccc(C(F)(F)F)cc3[C@H]3OCCC[C@H]32)c1 |
| InChI | InChI=1S/C19H17F4NO/c20-13-4-1-3-11(9-13)17-14-5-2-8-25-18(14)15-10-12(19(21,22)23)6-7-16(15)24-17/h1,3-4,6-7,9-10,14,17-18,24H,2,5,8H2/t14-,17-,18-/m0/s1 |
| InChIKey | SELPPIUWNUMKNU-WBAXXEDZSA-N |
| XLogP | 5.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |