C21H27NOS — CID 58956468
(4aS,5R,10bS)-9-tert-butyl-5-(5-methylthiophen-2-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956468) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is (4aS,5R,10bS)-9-tert-butyl-5-(5-methylthiophen-2-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (4aS,5R,10bS)-9-tert-butyl-5-(5-methylthiophen-2-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956468 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | (4aS,5R,10bS)-9-tert-butyl-5-(5-methylthiophen-2-yl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | Cc1ccc([C@@H]2Nc3ccc(C(C)(C)C)cc3[C@H]3OCCC[C@H]32)s1 |
| InChI | InChI=1S/C21H27NOS/c1-13-7-10-18(24-13)19-15-6-5-11-23-20(15)16-12-14(21(2,3)4)8-9-17(16)22-19/h7-10,12,15,19-20,22H,5-6,11H2,1-4H3/t15-,19+,20-/m0/s1 |
| InChIKey | HYDVCWWYCMFBPS-BEVDRBHNSA-N |
| XLogP | 5.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |