C20H18F3NO3 — CID 58956476
(4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-2-carboxylic acid (PubChem CID 58956476) has the molecular formula C20H18F3NO3 and a molecular weight of 377.36 g/mol. Its IUPAC name is (4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-2-carboxylic acid.
| Compound Name | (4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 58956476 |
| Molecular Formula | C20H18F3NO3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | (4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline-2-carboxylic acid |
| SMILES | O=C(O)C1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C20H18F3NO3/c21-20(22,23)12-6-8-15-14(10-12)18-13(7-9-16(27-18)19(25)26)17(24-15)11-4-2-1-3-5-11/h1-6,8,10,13,16-18,24H,7,9H2,(H,25,26)/t13-,16?,17-,18-/m0/s1 |
| InChIKey | SKUVEPDMZYSEKH-ZJGAOVERSA-N |
| XLogP | 4.79 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |