C25H30F3N3O — CID 58956510
(2R,4aS,5R,10bS)-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956510) has the molecular formula C25H30F3N3O and a molecular weight of 445.53 g/mol. Its IUPAC name is (2R,4aS,5R,10bS)-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | (2R,4aS,5R,10bS)-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956510 |
| Molecular Formula | C25H30F3N3O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | (2R,4aS,5R,10bS)-2-[(4-methylpiperazin-1-yl)methyl]-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | CN1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30F3N3O/c1-30-11-13-31(14-12-30)16-19-8-9-20-23(17-5-3-2-4-6-17)29-22-10-7-18(25(26,27)28)15-21(22)24(20)32-19/h2-7,10,15,19-20,23-24,29H,8-9,11-14,16H2,1H3/t19-,20+,23+,24+/m1/s1 |
| InChIKey | CMTFJGILOMAYTE-SHBJFUFKSA-N |
| XLogP | 4.96 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |