C27H27F3N2O — CID 58956517
1-[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-benzylmethanamine (PubChem CID 58956517) has the molecular formula C27H27F3N2O and a molecular weight of 452.52 g/mol. Its IUPAC name is 1-[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-benzylmethanamine.
| Compound Name | 1-[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-benzylmethanamine |
|---|---|
| PubChem CID | 58956517 |
| Molecular Formula | C27H27F3N2O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 1-[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]-N-benzylmethanamine |
| SMILES | FC(F)(F)c1ccc2c(c1)[C@H]1O[C@@H](CNCc3ccccc3)CC[C@H]1[C@H](c1ccccc1)N2 |
| InChI | InChI=1S/C27H27F3N2O/c28-27(29,30)20-11-14-24-23(15-20)26-22(25(32-24)19-9-5-2-6-10-19)13-12-21(33-26)17-31-16-18-7-3-1-4-8-18/h1-11,14-15,21-22,25-26,31-32H,12-13,16-17H2/t21-,22+,25+,26+/m1/s1 |
| InChIKey | IWYWWMUTDZOQTC-HRHCJDDBSA-N |
| XLogP | 6.50 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |