C25H30F3N3O — CID 58956521
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-amine (PubChem CID 58956521) has the molecular formula C25H30F3N3O and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-amine.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 58956521 |
| Molecular Formula | C25H30F3N3O |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidin-4-amine |
| SMILES | NC1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30F3N3O/c26-25(27,28)17-6-9-22-21(14-17)24-20(23(30-22)16-4-2-1-3-5-16)8-7-19(32-24)15-31-12-10-18(29)11-13-31/h1-6,9,14,18-20,23-24,30H,7-8,10-13,15,29H2/t19-,20+,23+,24+/m1/s1 |
| InChIKey | XMKJAJLTMHBNFD-SHBJFUFKSA-N |
| XLogP | 5.13 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |