C27H38N2O3 — CID 58956536
3-[9-tert-butyl-2-[[ethyl(2-hydroxyethyl)amino]methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol (PubChem CID 58956536) has the molecular formula C27H38N2O3 and a molecular weight of 438.61 g/mol. Its IUPAC name is 3-[9-tert-butyl-2-[[ethyl(2-hydroxyethyl)amino]methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol.
| Compound Name | 3-[9-tert-butyl-2-[[ethyl(2-hydroxyethyl)amino]methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol |
|---|---|
| PubChem CID | 58956536 |
| Molecular Formula | C27H38N2O3 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.29 |
| IUPAC Name | 3-[9-tert-butyl-2-[[ethyl(2-hydroxyethyl)amino]methyl]-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol |
| SMILES | CCN(CCO)CC1CCC2C(c3cccc(O)c3)Nc3ccc(C(C)(C)C)cc3C2O1 |
| InChI | InChI=1S/C27H38N2O3/c1-5-29(13-14-30)17-21-10-11-22-25(18-7-6-8-20(31)15-18)28-24-12-9-19(27(2,3)4)16-23(24)26(22)32-21/h6-9,12,15-16,21-22,25-26,28,30-31H,5,10-11,13-14,17H2,1-4H3 |
| InChIKey | DYFJPTAZMSOJER-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |