C30H36F3N3O5 — CID 58956624
1-O-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl] 4-O-tert-butyl piperazine-1,4-dicarboxylate (PubChem CID 58956624) has the molecular formula C30H36F3N3O5 and a molecular weight of 575.63 g/mol. Its IUPAC name is 1-O-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl] 4-O-tert-butyl piperazine-1,4-dicarboxylate.
| Compound Name | 1-O-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl] 4-O-tert-butyl piperazine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 58956624 |
| Molecular Formula | C30H36F3N3O5 |
| Molecular Weight | 575.63 g/mol |
| Exact Mass | 575.26 |
| IUPAC Name | 1-O-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl] 4-O-tert-butyl piperazine-1,4-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C30H36F3N3O5/c1-29(2,3)41-28(38)36-15-13-35(14-16-36)27(37)39-18-21-10-11-22-25(19-7-5-4-6-8-19)34-24-12-9-20(30(31,32)33)17-23(24)26(22)40-21/h4-9,12,17,21-22,25-26,34H,10-11,13-16,18H2,1-3H3/t21-,22+,25+,26+/m1/s1 |
| InChIKey | LWSVJAWTKPPKGC-HRHCJDDBSA-N |
| XLogP | 6.40 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.63 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |