C32H36F3N3O2 — CID 58956627
N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(4-aminobutyl)-2-phenylacetamide (PubChem CID 58956627) has the molecular formula C32H36F3N3O2 and a molecular weight of 551.65 g/mol. Its IUPAC name is N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(4-aminobutyl)-2-phenylacetamide.
| Compound Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(4-aminobutyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 58956627 |
| Molecular Formula | C32H36F3N3O2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | N-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(4-aminobutyl)-2-phenylacetamide |
| SMILES | NCCCCN(C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C32H36F3N3O2/c33-32(34,35)24-13-16-28-27(20-24)31-26(30(37-28)23-11-5-2-6-12-23)15-14-25(40-31)21-38(18-8-7-17-36)29(39)19-22-9-3-1-4-10-22/h1-6,9-13,16,20,25-26,30-31,37H,7-8,14-15,17-19,21,36H2/t25-,26+,30+,31+/m1/s1 |
| InChIKey | NYYBEVDBSMCFJI-IQNCFFCZSA-N |
| XLogP | 6.52 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|