C23H23F3N2O3 — CID 58956641
[4-[4-(2-oxopyrrolidin-1-yl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-2-yl]phenyl] propanoate (PubChem CID 58956641) has the molecular formula C23H23F3N2O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is [4-[4-(2-oxopyrrolidin-1-yl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-2-yl]phenyl] propanoate.
| Compound Name | [4-[4-(2-oxopyrrolidin-1-yl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-2-yl]phenyl] propanoate |
|---|---|
| PubChem CID | 58956641 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | [4-[4-(2-oxopyrrolidin-1-yl)-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-2-yl]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccc(C2CC(N3CCCC3=O)c3cc(C(F)(F)F)ccc3N2)cc1 |
| InChI | InChI=1S/C23H23F3N2O3/c1-2-22(30)31-16-8-5-14(6-9-16)19-13-20(28-11-3-4-21(28)29)17-12-15(23(24,25)26)7-10-18(17)27-19/h5-10,12,19-20,27H,2-4,11,13H2,1H3 |
| InChIKey | RRLGFTKPJSALPU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|