C19H16F5NO2 — CID 58956664
3-[(4aS,5R,10bS)-8,10-difluoro-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol (PubChem CID 58956664) has the molecular formula C19H16F5NO2 and a molecular weight of 385.33 g/mol. Its IUPAC name is 3-[(4aS,5R,10bS)-8,10-difluoro-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol.
| Compound Name | 3-[(4aS,5R,10bS)-8,10-difluoro-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol |
|---|---|
| PubChem CID | 58956664 |
| Molecular Formula | C19H16F5NO2 |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-[(4aS,5R,10bS)-8,10-difluoro-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-5-yl]phenol |
| SMILES | Oc1cccc([C@@H]2Nc3cc(F)c(C(F)(F)F)c(F)c3[C@H]3OCCC[C@H]32)c1 |
| InChI | InChI=1S/C19H16F5NO2/c20-12-8-13-14(16(21)15(12)19(22,23)24)18-11(5-2-6-27-18)17(25-13)9-3-1-4-10(26)7-9/h1,3-4,7-8,11,17-18,25-26H,2,5-6H2/t11-,17-,18-/m0/s1 |
| InChIKey | CFLUEKDIFPZQNW-NBHSMZAVSA-N |
| XLogP | 5.32 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |