C29H36F3N3O3 — CID 58956733
tert-butyl 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate (PubChem CID 58956733) has the molecular formula C29H36F3N3O3 and a molecular weight of 531.62 g/mol. Its IUPAC name is tert-butyl 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 58956733 |
| Molecular Formula | C29H36F3N3O3 |
| Molecular Weight | 531.62 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | tert-butyl 4-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C29H36F3N3O3/c1-28(2,3)38-27(36)35-15-13-34(14-16-35)18-21-10-11-22-25(19-7-5-4-6-8-19)33-24-12-9-20(29(30,31)32)17-23(24)26(22)37-21/h4-9,12,17,21-22,25-26,33H,10-11,13-16,18H2,1-3H3/t21-,22+,25+,26+/m1/s1 |
| InChIKey | YTAFYAMCPPLOAF-HRHCJDDBSA-N |
| XLogP | 6.26 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |