C24H29NO2 — CID 58956747
1-[(4aS,5R,10bS)-9-tert-butyl-5-phenyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-6-yl]ethanone (PubChem CID 58956747) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is 1-[(4aS,5R,10bS)-9-tert-butyl-5-phenyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-6-yl]ethanone.
| Compound Name | 1-[(4aS,5R,10bS)-9-tert-butyl-5-phenyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-6-yl]ethanone |
|---|---|
| PubChem CID | 58956747 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | 1-[(4aS,5R,10bS)-9-tert-butyl-5-phenyl-2,3,4,4a,5,10b-hexahydropyrano[3,2-c]quinolin-6-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(C(C)(C)C)cc2[C@H]2OCCC[C@H]2[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C24H29NO2/c1-16(26)25-21-13-12-18(24(2,3)4)15-20(21)23-19(11-8-14-27-23)22(25)17-9-6-5-7-10-17/h5-7,9-10,12-13,15,19,22-23H,8,11,14H2,1-4H3/t19-,22-,23-/m0/s1 |
| InChIKey | LJCAQYAEDCPKAR-VJBMBRPKSA-N |
| XLogP | 5.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |