C18H18F3NO2S — CID 58956756
[(2S,4aR,5S,10bR)-5-thiophen-3-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol (PubChem CID 58956756) has the molecular formula C18H18F3NO2S and a molecular weight of 369.41 g/mol. Its IUPAC name is [(2S,4aR,5S,10bR)-5-thiophen-3-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol.
| Compound Name | [(2S,4aR,5S,10bR)-5-thiophen-3-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol |
|---|---|
| PubChem CID | 58956756 |
| Molecular Formula | C18H18F3NO2S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(2S,4aR,5S,10bR)-5-thiophen-3-yl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methanol |
| SMILES | OC[C@@H]1CC[C@@H]2[C@@H](c3ccsc3)Nc3ccc(C(F)(F)F)cc3[C@@H]2O1 |
| InChI | InChI=1S/C18H18F3NO2S/c19-18(20,21)11-1-4-15-14(7-11)17-13(3-2-12(8-23)24-17)16(22-15)10-5-6-25-9-10/h1,4-7,9,12-13,16-17,22-23H,2-3,8H2/t12-,13+,16+,17+/m0/s1 |
| InChIKey | WYPKSAJLKPLQPR-NSNWQYSKSA-N |
| XLogP | 4.76 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |