C26H30F3N3O2 — CID 58956758
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidine-4-carboxamide (PubChem CID 58956758) has the molecular formula C26H30F3N3O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 58956758 |
| Molecular Formula | C26H30F3N3O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30F3N3O2/c27-26(28,29)18-6-9-22-21(14-18)24-20(23(31-22)16-4-2-1-3-5-16)8-7-19(34-24)15-32-12-10-17(11-13-32)25(30)33/h1-6,9,14,17,19-20,23-24,31H,7-8,10-13,15H2,(H2,30,33)/t19-,20+,23+,24+/m1/s1 |
| InChIKey | XWLIJQLKQMUENI-SHBJFUFKSA-N |
| XLogP | 4.91 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |