C19H21NOS — CID 58956771
7-cyclopropyl-5-thiophen-3-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline (PubChem CID 58956771) has the molecular formula C19H21NOS and a molecular weight of 311.45 g/mol. Its IUPAC name is 7-cyclopropyl-5-thiophen-3-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline.
| Compound Name | 7-cyclopropyl-5-thiophen-3-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
|---|---|
| PubChem CID | 58956771 |
| Molecular Formula | C19H21NOS |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 7-cyclopropyl-5-thiophen-3-yl-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinoline |
| SMILES | c1cc(C2CC2)c2c(c1)C1OCCCC1C(c1ccsc1)N2 |
| InChI | InChI=1S/C19H21NOS/c1-3-14(12-6-7-12)18-16(4-1)19-15(5-2-9-21-19)17(20-18)13-8-10-22-11-13/h1,3-4,8,10-12,15,17,19-20H,2,5-7,9H2 |
| InChIKey | CWCMZPQYAKKTJO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |