C29H31F3N4O2 — CID 58956781
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-(2-aminoethyl)-3-phenylurea (PubChem CID 58956781) has the molecular formula C29H31F3N4O2 and a molecular weight of 524.59 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-(2-aminoethyl)-3-phenylurea.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-(2-aminoethyl)-3-phenylurea |
|---|---|
| PubChem CID | 58956781 |
| Molecular Formula | C29H31F3N4O2 |
| Molecular Weight | 524.59 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-1-(2-aminoethyl)-3-phenylurea |
| SMILES | NCCN(C[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H31F3N4O2/c30-29(31,32)20-11-14-25-24(17-20)27-23(26(35-25)19-7-3-1-4-8-19)13-12-22(38-27)18-36(16-15-33)28(37)34-21-9-5-2-6-10-21/h1-11,14,17,22-23,26-27,35H,12-13,15-16,18,33H2,(H,34,37)/t22-,23+,26+,27+/m1/s1 |
| InChIKey | MYILDOOIMFMKRX-DTBHQADXSA-N |
| XLogP | 6.20 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.59 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |