C31H33F4N3O — CID 58956785
1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(4-fluorophenyl)piperidin-4-amine (PubChem CID 58956785) has the molecular formula C31H33F4N3O and a molecular weight of 539.62 g/mol. Its IUPAC name is 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(4-fluorophenyl)piperidin-4-amine.
| Compound Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(4-fluorophenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 58956785 |
| Molecular Formula | C31H33F4N3O |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 1-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-(4-fluorophenyl)piperidin-4-amine |
| SMILES | Fc1ccc(NC2CCN(C[C@H]3CC[C@@H]4[C@H](O3)c3cc(C(F)(F)F)ccc3N[C@H]4c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C31H33F4N3O/c32-22-7-9-23(10-8-22)36-24-14-16-38(17-15-24)19-25-11-12-26-29(20-4-2-1-3-5-20)37-28-13-6-21(31(33,34)35)18-27(28)30(26)39-25/h1-10,13,18,24-26,29-30,36-37H,11-12,14-17,19H2/t25-,26+,29+,30+/m1/s1 |
| InChIKey | JOFKKIJCCCBISD-UUHGVMMKSA-N |
| XLogP | 7.42 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |