C29H39F3N4O2 — CID 58956798
2-[4-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]piperazin-1-yl]ethanol (PubChem CID 58956798) has the molecular formula C29H39F3N4O2 and a molecular weight of 532.65 g/mol. Its IUPAC name is 2-[4-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 58956798 |
| Molecular Formula | C29H39F3N4O2 |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 2-[4-[3-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methylamino]propyl]piperazin-1-yl]ethanol |
| SMILES | OCCN1CCN(CCCNC[C@H]2CC[C@@H]3[C@H](O2)c2cc(C(F)(F)F)ccc2N[C@H]3c2ccccc2)CC1 |
| InChI | InChI=1S/C29H39F3N4O2/c30-29(31,32)22-7-10-26-25(19-22)28-24(27(34-26)21-5-2-1-3-6-21)9-8-23(38-28)20-33-11-4-12-35-13-15-36(16-14-35)17-18-37/h1-3,5-7,10,19,23-24,27-28,33-34,37H,4,8-9,11-18,20H2/t23-,24+,27+,28+/m1/s1 |
| InChIKey | DMRJSPFYFPMQEW-JGPKDBRGSA-N |
| XLogP | 4.30 |
| TPSA | 60.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|