About 1,2-diphenylpiperidin-4-ol
1,2-diphenylpiperidin-4-ol (PubChem CID 58956930) has the molecular formula C17H19NO
and a molecular weight of 253.35 g/mol. Its IUPAC name is 1,2-diphenylpiperidin-4-ol.
Molecular Properties
| Compound Name | 1,2-diphenylpiperidin-4-ol |
| PubChem CID | 58956930 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 1,2-diphenylpiperidin-4-ol |
| SMILES | OC1CCN(c2ccccc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H19NO/c19-16-11-12-18(15-9-5-2-6-10-15)17(13-16)14-7-3-1-4-8-14/h1-10,16-17,19H,11-13H2 |
| InChIKey | DPRCEJMCMCDQRA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,2-diphenylpiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diphenylpiperidin-4-ol?
The IUPAC name of 1,2-diphenylpiperidin-4-ol (CID 58956930) is 1,2-diphenylpiperidin-4-ol.
What is the SMILES notation for 1,2-diphenylpiperidin-4-ol?
The canonical SMILES for 1,2-diphenylpiperidin-4-ol is OC1CCN(c2ccccc2)C(c2ccccc2)C1.
What is the InChIKey of 1,2-diphenylpiperidin-4-ol?
The InChIKey is DPRCEJMCMCDQRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO/c19-16-11-12-18(15-9-5-2-6-10-15)17(13-16)14-7-3-1-4-8-14/h1-10,16-17,19H,11-13H2.
What are the key properties of 1,2-diphenylpiperidin-4-ol?
1,2-diphenylpiperidin-4-ol has a molecular weight of 253.35 g/mol, XLogP of 3.39, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diphenylpiperidin-4-ol is sourced from PubChem (CID 58956930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).