About (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine
(2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine (PubChem CID 58957018) has the molecular formula C22H27Cl2NO
and a molecular weight of 392.37 g/mol. Its IUPAC name is (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine.
Molecular Properties
| Compound Name | (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine |
| PubChem CID | 58957018 |
| Molecular Formula | C22H27Cl2NO |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine |
| SMILES | CC(C)COC[C@@H]1CC[C@@H](c2ccc(Cl)cc2)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H27Cl2NO/c1-16(2)14-26-15-17-3-12-22(18-4-6-19(23)7-5-18)25(13-17)21-10-8-20(24)9-11-21/h4-11,16-17,22H,3,12-15H2,1-2H3/t17-,22+/m1/s1 |
| InChIKey | YDWGMMUBSOUYOA-VGSWGCGISA-N |
| XLogP | 6.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine?
The IUPAC name of (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine (CID 58957018) is (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine.
What is the SMILES notation for (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine?
The canonical SMILES for (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine is CC(C)COC[C@@H]1CC[C@@H](c2ccc(Cl)cc2)N(c2ccc(Cl)cc2)C1.
What is the InChIKey of (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine?
The InChIKey is YDWGMMUBSOUYOA-VGSWGCGISA-N. The full InChI is InChI=1S/C22H27Cl2NO/c1-16(2)14-26-15-17-3-12-22(18-4-6-19(23)7-5-18)25(13-17)21-10-8-20(24)9-11-21/h4-11,16-17,22H,3,12-15H2,1-2H3/t17-,22+/m1/s1.
What are the key properties of (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine?
(2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine has a molecular weight of 392.37 g/mol, XLogP of 6.62, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-1,2-bis(4-chlorophenyl)-5-(2-methylpropoxymethyl)piperidine is sourced from PubChem (CID 58957018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).