About [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol
[(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol (PubChem CID 58957027) has the molecular formula C18H19Cl2NO
and a molecular weight of 336.26 g/mol. Its IUPAC name is [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol |
| PubChem CID | 58957027 |
| Molecular Formula | C18H19Cl2NO |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol |
| SMILES | OC[C@@H]1CC[C@@H](c2ccc(Cl)cc2)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H19Cl2NO/c19-15-4-2-14(3-5-15)18-10-1-13(12-22)11-21(18)17-8-6-16(20)7-9-17/h2-9,13,18,22H,1,10-12H2/t13-,18+/m1/s1 |
| InChIKey | NAQSQBHNAKRNQO-ACJLOTCBSA-N |
| XLogP | 4.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol?
The IUPAC name of [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol (CID 58957027) is [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol.
What is the SMILES notation for [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol?
The canonical SMILES for [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol is OC[C@@H]1CC[C@@H](c2ccc(Cl)cc2)N(c2ccc(Cl)cc2)C1.
What is the InChIKey of [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol?
The InChIKey is NAQSQBHNAKRNQO-ACJLOTCBSA-N. The full InChI is InChI=1S/C18H19Cl2NO/c19-15-4-2-14(3-5-15)18-10-1-13(12-22)11-21(18)17-8-6-16(20)7-9-17/h2-9,13,18,22H,1,10-12H2/t13-,18+/m1/s1.
What are the key properties of [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol?
[(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol has a molecular weight of 336.26 g/mol, XLogP of 4.94, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6S)-1,6-bis(4-chlorophenyl)piperidin-3-yl]methanol is sourced from PubChem (CID 58957027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).