About 4-methyl-5H-pyrrolo[3,2-c]pyridazine
4-methyl-5H-pyrrolo[3,2-c]pyridazine (PubChem CID 58957234) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 4-methyl-5H-pyrrolo[3,2-c]pyridazine.
Molecular Properties
| Compound Name | 4-methyl-5H-pyrrolo[3,2-c]pyridazine |
| PubChem CID | 58957234 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 4-methyl-5H-pyrrolo[3,2-c]pyridazine |
| SMILES | Cc1cnnc2cc[nH]c12 |
| InChI | InChI=1S/C7H7N3/c1-5-4-9-10-6-2-3-8-7(5)6/h2-4,8H,1H3 |
| InChIKey | ARGSEBLKYMLOAG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-5H-pyrrolo[3,2-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5H-pyrrolo[3,2-c]pyridazine?
The IUPAC name of 4-methyl-5H-pyrrolo[3,2-c]pyridazine (CID 58957234) is 4-methyl-5H-pyrrolo[3,2-c]pyridazine.
What is the SMILES notation for 4-methyl-5H-pyrrolo[3,2-c]pyridazine?
The canonical SMILES for 4-methyl-5H-pyrrolo[3,2-c]pyridazine is Cc1cnnc2cc[nH]c12.
What is the InChIKey of 4-methyl-5H-pyrrolo[3,2-c]pyridazine?
The InChIKey is ARGSEBLKYMLOAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-5-4-9-10-6-2-3-8-7(5)6/h2-4,8H,1H3.
What are the key properties of 4-methyl-5H-pyrrolo[3,2-c]pyridazine?
4-methyl-5H-pyrrolo[3,2-c]pyridazine has a molecular weight of 133.15 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5H-pyrrolo[3,2-c]pyridazine is sourced from PubChem (CID 58957234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).