About 7-methyl-5H-pyrrolo[3,2-d]pyrimidine
7-methyl-5H-pyrrolo[3,2-d]pyrimidine (PubChem CID 58957259) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 7-methyl-5H-pyrrolo[3,2-d]pyrimidine.
Molecular Properties
| Compound Name | 7-methyl-5H-pyrrolo[3,2-d]pyrimidine |
| PubChem CID | 58957259 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 7-methyl-5H-pyrrolo[3,2-d]pyrimidine |
| SMILES | Cc1c[nH]c2cncnc12 |
| InChI | InChI=1S/C7H7N3/c1-5-2-9-6-3-8-4-10-7(5)6/h2-4,9H,1H3 |
| InChIKey | CQBATHGZXBMXBA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-5H-pyrrolo[3,2-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The IUPAC name of 7-methyl-5H-pyrrolo[3,2-d]pyrimidine (CID 58957259) is 7-methyl-5H-pyrrolo[3,2-d]pyrimidine.
What is the SMILES notation for 7-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The canonical SMILES for 7-methyl-5H-pyrrolo[3,2-d]pyrimidine is Cc1c[nH]c2cncnc12.
What is the InChIKey of 7-methyl-5H-pyrrolo[3,2-d]pyrimidine?
The InChIKey is CQBATHGZXBMXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-5-2-9-6-3-8-4-10-7(5)6/h2-4,9H,1H3.
What are the key properties of 7-methyl-5H-pyrrolo[3,2-d]pyrimidine?
7-methyl-5H-pyrrolo[3,2-d]pyrimidine has a molecular weight of 133.15 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5H-pyrrolo[3,2-d]pyrimidine is sourced from PubChem (CID 58957259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).