C41H33N3S — CID 58957677
2-[(Z)-[7-(4-benzo[b][1]benzazepin-11-ylphenyl)-4,4-dimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene]-isocyanomethyl]-1,3-benzothiazole (PubChem CID 58957677) has the molecular formula C41H33N3S and a molecular weight of 599.80 g/mol. Its IUPAC name is 2-[(Z)-[7-(4-benzo[b][1]benzazepin-11-ylphenyl)-4,4-dimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene]-isocyanomethyl]-1,3-benzothiazole.
| Compound Name | 2-[(Z)-[7-(4-benzo[b][1]benzazepin-11-ylphenyl)-4,4-dimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene]-isocyanomethyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 58957677 |
| Molecular Formula | C41H33N3S |
| Molecular Weight | 599.80 g/mol |
| Exact Mass | 599.24 |
| IUPAC Name | 2-[(Z)-[7-(4-benzo[b][1]benzazepin-11-ylphenyl)-4,4-dimethyl-3,4a,5,6-tetrahydronaphthalen-2-ylidene]-isocyanomethyl]-1,3-benzothiazole |
| SMILES | [C-]#[N+]/C(=C1\C=C2C=C(c3ccc(N4c5ccccc5C=Cc5ccccc54)cc3)CCC2C(C)(C)C1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C41H33N3S/c1-41(2)26-32(39(42-3)40-43-35-12-6-9-15-38(35)45-40)25-31-24-30(20-23-34(31)41)27-18-21-33(22-19-27)44-36-13-7-4-10-28(36)16-17-29-11-5-8-14-37(29)44/h4-19,21-22,24-25,34H,20,23,26H2,1-2H3/b39-32+ |
| InChIKey | FJCNGALDCGBHQV-LETMKSKHSA-N |
| XLogP | 11.73 |
| TPSA | 20.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.80 |
| LogP ≤ 5 | 11.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|