C22H28N2O2 — CID 58957725
5,8-bis(butylamino)-2,3-dihydroanthracene-9,10-dione (PubChem CID 58957725) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 5,8-bis(butylamino)-2,3-dihydroanthracene-9,10-dione.
| Compound Name | 5,8-bis(butylamino)-2,3-dihydroanthracene-9,10-dione |
|---|---|
| PubChem CID | 58957725 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 5,8-bis(butylamino)-2,3-dihydroanthracene-9,10-dione |
| SMILES | CCCCNc1ccc(NCCCC)c2c1C(=O)C1=CCCC=C1C2=O |
| InChI | InChI=1S/C22H28N2O2/c1-3-5-13-23-17-11-12-18(24-14-6-4-2)20-19(17)21(25)15-9-7-8-10-16(15)22(20)26/h9-12,23-24H,3-8,13-14H2,1-2H3 |
| InChIKey | XGPBSTVNJXPRCD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|