C10H11F3 — CID 58957734
3,3,4-trifluoro-4-methyltricyclo[4.2.1.02,5]non-7-ene (PubChem CID 58957734) has the molecular formula C10H11F3 and a molecular weight of 188.19 g/mol. Its IUPAC name is 3,3,4-trifluoro-4-methyltricyclo[4.2.1.02,5]non-7-ene.
| Compound Name | 3,3,4-trifluoro-4-methyltricyclo[4.2.1.02,5]non-7-ene |
|---|---|
| PubChem CID | 58957734 |
| Molecular Formula | C10H11F3 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3,3,4-trifluoro-4-methyltricyclo[4.2.1.02,5]non-7-ene |
| SMILES | CC1(F)C2C3C=CC(C3)C2C1(F)F |
| InChI | InChI=1S/C10H11F3/c1-9(11)7-5-2-3-6(4-5)8(7)10(9,12)13/h2-3,5-8H,4H2,1H3 |
| InChIKey | FIICKHVBSBCMFJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|