C14H28O3Si — CID 58958851
ethyl-dimethyl-[2-methyl-1,3-bis(prop-2-enoxy)propan-2-yl]oxysilane (PubChem CID 58958851) has the molecular formula C14H28O3Si and a molecular weight of 272.46 g/mol. Its IUPAC name is ethyl-dimethyl-[2-methyl-1,3-bis(prop-2-enoxy)propan-2-yl]oxysilane.
| Compound Name | ethyl-dimethyl-[2-methyl-1,3-bis(prop-2-enoxy)propan-2-yl]oxysilane |
|---|---|
| PubChem CID | 58958851 |
| Molecular Formula | C14H28O3Si |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | ethyl-dimethyl-[2-methyl-1,3-bis(prop-2-enoxy)propan-2-yl]oxysilane |
| SMILES | C=CCOCC(C)(COCC=C)O[Si](C)(C)CC |
| InChI | InChI=1S/C14H28O3Si/c1-7-10-15-12-14(4,13-16-11-8-2)17-18(5,6)9-3/h7-8H,1-2,9-13H2,3-6H3 |
| InChIKey | GTCGIMXMFAXWRG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|